3,4,5-Trifluorophenylacetic acid - Names and Identifiers
| Name | 3,4,5-(trifluorophenyl)acetic acid
|
| Synonyms | RARECHEM AL BO 0708 3,4,5-TRIFLUOROPHENYLACETIC ACID 3,4,5-Trifluorophenylacetic acid 3,4,5-Trifluorophenyl acetic acid 3,4,5-Trifluorobenzoic Acetic Acid 3,4,5-TRIFLUOROBENZENE ACETIC ACID 3,4,5-(trifluorophenyl)acetic acid 2-(3,4,5-trifluorophenyl)acetic acid Benzeneacetic acid, 3,4,5-trifluoro-
|
| CAS | 209991-62-8
|
| InChI | InChI=1/C8H5F3O2/c9-5-1-4(3-7(12)13)2-6(10)8(5)11/h1-2H,3H2,(H,12,13) |
3,4,5-Trifluorophenylacetic acid - Physico-chemical Properties
| Molecular Formula | C8H5F3O2
|
| Molar Mass | 190.12 |
| Density | 1.468±0.06 g/cm3(Predicted) |
| Melting Point | 98-101℃ |
| Boling Point | 254.6±35.0 °C(Predicted) |
| Flash Point | 107.8°C |
| Vapor Presure | 0.00885mmHg at 25°C |
| Appearance | White crystalline powder |
| pKa | 3.86±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.488 |
| MDL | MFCD00083532 |
3,4,5-Trifluorophenylacetic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant

|
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
|
| Hazard Class | IRRITANT |
3,4,5-Trifluorophenylacetic acid - Introduction
3,4,5-(trifluorophenyl)acetic acid is an organic compound with the chemical formula C8H5F3O2. It has the following properties:
1. Appearance: colorless or white crystal.
2. Melting Point: about 70-73 degrees Celsius.
3. Boiling point: About 196 degrees Celsius.
4. Solubility: Soluble in organic solvents, such as ethanol and ether, slightly soluble in water.
5. Acidity: acidic, can react with alkali to generate the corresponding salt.
3,4,5-(trifluorophenyl)acetic acid has a wide range of uses in chemistry and industry:
1. Chemical reagents: can be used as intermediates and catalysts for organic synthesis.
2. Surfactant: It can be used to prepare surfactants, such as surfactants and emulsifiers.
3. Preservatives: can be used for food, drugs and cosmetics products such as preservation.
There are many methods for preparing 3,4,5-(trifluorophenyl)acetic acid. A common method is obtained by transesterification of trifluorotoluene and ethylene acid.
Regarding safety information, you need to pay attention to the following points:
1. Toxicity: 3,4,5-(trifluorophenyl)acetic acid has a certain toxicity, contact or inhalation of high concentrations of gas or dust in the work environment may cause eye, skin and respiratory tract irritation.
2. Protective measures: When handling 3,4,5-(trifluorophenyl)acetic acid, wear protective gloves, goggles and protective clothing, and ensure good ventilation.
3. Storage and handling: 3,4,5-(trifluorophenyl)acetic acid should be stored in a dry, well-ventilated place, and away from fire and flammable materials. Observe relevant regulations and safe operating procedures when handling and discarding.
Last Update:2024-04-09 19:05:47